What is the [(1-nitro-2-naphthyl)oxy]acetic acid?

[(1-nitro-2-naphthyl)oxy]acetic acid is , while it's Molecular Formula is C12H9 N O5. Used in Pharmaceutical Industry: [(1-nitro-2-naphthyl)oxy]acetic acid is used as a precursor in the synthesis of pharmaceuticals for its ability to undergo chemical reactions such as reduction and substitution, leading to the development of a diverse array of compounds with distinct properties and therapeutic applications. Used in Agrochemical Industry: In the agrochemical sector, [(1-nitro-2-naphthyl)oxy]acetic acid is utilized as a starting material for the production of various agrochemicals, capitalizing on its reactivity to create compounds that can be employed in crop protection and enhancement of agricultural yields. Used in Chemistry Research: [(1-nitro-2-naphthyl)oxy]acetic acid is used as a research compound in the field of chemistry to explore novel reactions and mechanisms, contributing to the advancement of chemical knowledge and the discovery of new chemical processes. Used in Materials Science: Within the realm of materials science, [(1-nitro-2-naphthyl)oxy]acetic acid is employed in the development of new materials, leveraging its reactive nature to engineer materials with specific properties for various applications, such as in sensors, coatings, or advanced composites.

What is the CAS number for [(1-nitro-2-naphthyl)oxy]acetic acid?

The CAS number of [(1-nitro-2-naphthyl)oxy]acetic acid is 10440-91-2.

What is [(1-nitro-2-naphthyl)oxy]acetic acid (10440-91-2) used for?

[(1-nitro-2-naphthyl)oxy]acetic acid, commonly referred to as NOA, is a nitro derivative of naphthalene characterized by its unique reactivity due to the presence of a nitro group. This chemical compound serves as a versatile building block in the synthesis of a variety of organic compounds and is recognized for its potential in the creation of pharmaceuticals and agrochemicals.InChI:InChI=1/C12H9NO5/c14-11(15)7-18-10-6-5-8-3-1-2-4-9(8)12(10)13(16)17/h1-6H,7H2,(H,14,15)

What is the [(1-nitro-2-naphthyl)oxy]acetic acid?

[(1-nitro-2-naphthyl)oxy]acetic acid is , while it's Molecular Formula is C12H9 N O5. Used in Pharmaceutical Industry: [(1-nitro-2-naphthyl)oxy]acetic acid is used as a precursor in the synthesis of pharmaceuticals for its ability to undergo chemical reactions such as reduction and substitution, leading to the development of a diverse array of compounds with distinct properties and therapeutic applications. Used in Agrochemical Industry: In the agrochemical sector, [(1-nitro-2-naphthyl)oxy]acetic acid is utilized as a starting material for the production of various agrochemicals, capitalizing on its reactivity to create compounds that can be employed in crop protection and enhancement of agricultural yields. Used in Chemistry Research: [(1-nitro-2-naphthyl)oxy]acetic acid is used as a research compound in the field of chemistry to explore novel reactions and mechanisms, contributing to the advancement of chemical knowledge and the discovery of new chemical processes. Used in Materials Science: Within the realm of materials science, [(1-nitro-2-naphthyl)oxy]acetic acid is employed in the development of new materials, leveraging its reactive nature to engineer materials with specific properties for various applications, such as in sensors, coatings, or advanced composites.

What is the CAS number for [(1-nitro-2-naphthyl)oxy]acetic acid?

The CAS number of [(1-nitro-2-naphthyl)oxy]acetic acid is 10440-91-2.

What is [(1-nitro-2-naphthyl)oxy]acetic acid (10440-91-2) used for?

[(1-nitro-2-naphthyl)oxy]acetic acid, commonly referred to as NOA, is a nitro derivative of naphthalene characterized by its unique reactivity due to the presence of a nitro group. This chemical compound serves as a versatile building block in the synthesis of a variety of organic compounds and is recognized for its potential in the creation of pharmaceuticals and agrochemicals.InChI:InChI=1/C12H9NO5/c14-11(15)7-18-10-6-5-8-3-1-2-4-9(8)12(10)13(16)17/h1-6H,7H2,(H,14,15)

[(1-nitro-2-naphthyl)oxy]acetic acid

Current location：Home > Products > [(1-nitro-2-naphthyl)oxy]acetic acid

[(1-nitro-2-naphthyl)oxy]acetic acid

Name[(1-nitro-2-naphthyl)oxy]acetic acid
CAS10440-91-2
Purity99%

Inquiry

Product Details

Chinese Manufacturer Supply [(1-nitro-2-naphthyl)oxy]acetic acid 10440-91-2 On Stock with Competitive Price

Molecular Formula:C12H9 N O5
Molecular Weight:247.207
Vapor Pressure:8.43E-10mmHg at 25°C
Boiling Point:474.3°Cat760mmHg
Flash Point:240.6°C
PSA：92.35000
Density:1.449g/cm³
LogP:2.73460

[(1-nitro-2-naphthyl)oxy]acetic acid(Cas 10440-91-2) Usage

General Description

The chemical compound [(1-nitro-2-naphthyl)oxy]acetic acid, also known as NOA, is a nitro derivative of naphthalene. It is used in the synthesis of various organic compounds and can act as a precursor in the production of pharmaceuticals and agrochemicals. NOA is known for its nitro group, which imparts a unique reactivity to the compound. It can undergo various chemical reactions, including reduction and substitution, to produce a wide range of derivatives with different properties and functions. NOA has applications in the fields of chemistry, pharmacology, and materials science due to its versatile reactivity and potential for creating new compounds with valuable properties.

InChI:InChI=1/C12H9NO5/c14-11(15)7-18-10-6-5-8-3-1-2-4-9(8)12(10)13(16)17/h1-6H,7H2,(H,14,15)

10440-91-2 Process route

: 120-23-0
(2-naphthoyl)oxyacetic acid

: 10440-91-2
(1-nitro-[2]naphthyloxy)-acetic acid

: 861066-65-1
(6-nitro-[2]naphthyloxy)-acetic acid

Conditions

Conditions	Yield
With nitric acid; acetic acid;

: 135-19-3
β-naphthol

: 10440-91-2
(1-nitro-[2]naphthyloxy)-acetic acid

Conditions

Conditions	Yield
Multi-step reaction with 2 steps 1: KOH-solution 2: durch Nitrierung With potassium hydroxide;
Multi-step reaction with 2 steps 1: KOH-solution; water / Faellen mit Salzsaeure 2: durch Nitrierung With potassium hydroxide; water;